C24H23NS2 — CID 140521505
benzyl 3-(2,4-dimethylphenyl)sulfanyl-N-phenylprop-2-enimidothioate (PubChem CID 140521505) has the molecular formula C24H23NS2 and a molecular weight of 389.59 g/mol. Its IUPAC name is benzyl 3-(2,4-dimethylphenyl)sulfanyl-N-phenylprop-2-enimidothioate.
| Compound Name | benzyl 3-(2,4-dimethylphenyl)sulfanyl-N-phenylprop-2-enimidothioate |
|---|---|
| PubChem CID | 140521505 |
| Molecular Formula | C24H23NS2 |
| Molecular Weight | 389.59 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | benzyl 3-(2,4-dimethylphenyl)sulfanyl-N-phenylprop-2-enimidothioate |
| SMILES | Cc1ccc(SC=C/C(=N/c2ccccc2)SCc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C24H23NS2/c1-19-13-14-23(20(2)17-19)26-16-15-24(25-22-11-7-4-8-12-22)27-18-21-9-5-3-6-10-21/h3-17H,18H2,1-2H3/b16-15?,25-24- |
| InChIKey | IGVBEMKFILYUOB-UJXZPIBZSA-N |
| XLogP | 7.57 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.59 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|