C25H25NOS2 — CID 140521459
2-phenylethyl 3-(3-methoxyphenyl)sulfanyl-N-(4-methylphenyl)prop-2-enimidothioate (PubChem CID 140521459) has the molecular formula C25H25NOS2 and a molecular weight of 419.62 g/mol. Its IUPAC name is 2-phenylethyl 3-(3-methoxyphenyl)sulfanyl-N-(4-methylphenyl)prop-2-enimidothioate.
| Compound Name | 2-phenylethyl 3-(3-methoxyphenyl)sulfanyl-N-(4-methylphenyl)prop-2-enimidothioate |
|---|---|
| PubChem CID | 140521459 |
| Molecular Formula | C25H25NOS2 |
| Molecular Weight | 419.62 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 2-phenylethyl 3-(3-methoxyphenyl)sulfanyl-N-(4-methylphenyl)prop-2-enimidothioate |
| SMILES | COc1cccc(SC=C/C(=N/c2ccc(C)cc2)SCCc2ccccc2)c1 |
| InChI | InChI=1S/C25H25NOS2/c1-20-11-13-22(14-12-20)26-25(29-17-15-21-7-4-3-5-8-21)16-18-28-24-10-6-9-23(19-24)27-2/h3-14,16,18-19H,15,17H2,1-2H3/b18-16?,26-25- |
| InChIKey | BERWOZPUHYPSEU-CTPJNKBJSA-N |
| XLogP | 7.32 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.62 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|