C20H22ClNS2 — CID 140521509
2-methylpropyl 3-(2-chlorophenyl)sulfanyl-N-(4-methylphenyl)prop-2-enimidothioate (PubChem CID 140521509) has the molecular formula C20H22ClNS2 and a molecular weight of 375.99 g/mol. Its IUPAC name is 2-methylpropyl 3-(2-chlorophenyl)sulfanyl-N-(4-methylphenyl)prop-2-enimidothioate.
| Compound Name | 2-methylpropyl 3-(2-chlorophenyl)sulfanyl-N-(4-methylphenyl)prop-2-enimidothioate |
|---|---|
| PubChem CID | 140521509 |
| Molecular Formula | C20H22ClNS2 |
| Molecular Weight | 375.99 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 2-methylpropyl 3-(2-chlorophenyl)sulfanyl-N-(4-methylphenyl)prop-2-enimidothioate |
| SMILES | Cc1ccc(/N=C(/C=CSc2ccccc2Cl)SCC(C)C)cc1 |
| InChI | InChI=1S/C20H22ClNS2/c1-15(2)14-24-20(22-17-10-8-16(3)9-11-17)12-13-23-19-7-5-4-6-18(19)21/h4-13,15H,14H2,1-3H3/b13-12?,22-20- |
| InChIKey | JZBQDXTYPICDEY-VFIZFFMBSA-N |
| XLogP | 7.37 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.99 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|