C25H24FNS2 — CID 140521525
1-phenylpropyl 3-(4-fluorophenyl)sulfanyl-N-(4-methylphenyl)prop-2-enimidothioate (PubChem CID 140521525) has the molecular formula C25H24FNS2 and a molecular weight of 421.61 g/mol. Its IUPAC name is 1-phenylpropyl 3-(4-fluorophenyl)sulfanyl-N-(4-methylphenyl)prop-2-enimidothioate.
| Compound Name | 1-phenylpropyl 3-(4-fluorophenyl)sulfanyl-N-(4-methylphenyl)prop-2-enimidothioate |
|---|---|
| PubChem CID | 140521525 |
| Molecular Formula | C25H24FNS2 |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 1-phenylpropyl 3-(4-fluorophenyl)sulfanyl-N-(4-methylphenyl)prop-2-enimidothioate |
| SMILES | CCC(S/C(C=CSc1ccc(F)cc1)=N/c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H24FNS2/c1-3-24(20-7-5-4-6-8-20)29-25(27-22-13-9-19(2)10-14-22)17-18-28-23-15-11-21(26)12-16-23/h4-18,24H,3H2,1-2H3/b18-17?,27-25+ |
| InChIKey | NWYDBBOXNDSVEB-FHSBBDARSA-N |
| XLogP | 8.35 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|