C22H18F2N2O4S — CID 25262589
2-(4-cyclopropylsulfonylphenyl)-2-(2,4-difluorophenoxy)-N-pyridin-2-ylacetamide (PubChem CID 25262589) has the molecular formula C22H18F2N2O4S and a molecular weight of 444.46 g/mol. Its IUPAC name is 2-(4-cyclopropylsulfonylphenyl)-2-(2,4-difluorophenoxy)-N-pyridin-2-ylacetamide.
| Compound Name | 2-(4-cyclopropylsulfonylphenyl)-2-(2,4-difluorophenoxy)-N-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 25262589 |
| Molecular Formula | C22H18F2N2O4S |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 2-(4-cyclopropylsulfonylphenyl)-2-(2,4-difluorophenoxy)-N-pyridin-2-ylacetamide |
| SMILES | O=C(Nc1ccccn1)C(Oc1ccc(F)cc1F)c1ccc(S(=O)(=O)C2CC2)cc1 |
| InChI | InChI=1S/C22H18F2N2O4S/c23-15-6-11-19(18(24)13-15)30-21(22(27)26-20-3-1-2-12-25-20)14-4-7-16(8-5-14)31(28,29)17-9-10-17/h1-8,11-13,17,21H,9-10H2,(H,25,26,27) |
| InChIKey | GHVBYEZMHNPLOY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |