C16H18N2O5 — CID 2526259
N-[3-(2,4-dimethoxyanilino)-3-oxopropyl]furan-2-carboxamide (PubChem CID 2526259) has the molecular formula C16H18N2O5 and a molecular weight of 318.33 g/mol. Its IUPAC name is N-[3-(2,4-dimethoxyanilino)-3-oxopropyl]furan-2-carboxamide.
| Compound Name | N-[3-(2,4-dimethoxyanilino)-3-oxopropyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 2526259 |
| Molecular Formula | C16H18N2O5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-[3-(2,4-dimethoxyanilino)-3-oxopropyl]furan-2-carboxamide |
| SMILES | COc1ccc(NC(=O)CCNC(=O)c2ccco2)c(OC)c1 |
| InChI | InChI=1S/C16H18N2O5/c1-21-11-5-6-12(14(10-11)22-2)18-15(19)7-8-17-16(20)13-4-3-9-23-13/h3-6,9-10H,7-8H2,1-2H3,(H,17,20)(H,18,19) |
| InChIKey | KPLKFMIPFJOATM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |