C21H35FN2O2 — CID 25262826
(2R,3E,8R,9S,10S,13S,14S,17S)-3-(2-aminoethoxyimino)-2-fluoro-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 25262826) has the molecular formula C21H35FN2O2 and a molecular weight of 366.52 g/mol. Its IUPAC name is (2R,3E,8R,9S,10S,13S,14S,17S)-3-(2-aminoethoxyimino)-2-fluoro-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (2R,3E,8R,9S,10S,13S,14S,17S)-3-(2-aminoethoxyimino)-2-fluoro-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 25262826 |
| Molecular Formula | C21H35FN2O2 |
| Molecular Weight | 366.52 g/mol |
| Exact Mass | 366.27 |
| IUPAC Name | (2R,3E,8R,9S,10S,13S,14S,17S)-3-(2-aminoethoxyimino)-2-fluoro-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4C/C(=N\OCCN)[C@H](F)C[C@@]43C)[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C21H35FN2O2/c1-20-8-7-16-14(15(20)5-6-19(20)25)4-3-13-11-18(24-26-10-9-23)17(22)12-21(13,16)2/h13-17,19,25H,3-12,23H2,1-2H3/b24-18+/t13?,14-,15-,16-,17+,19-,20-,21-/m0/s1 |
| InChIKey | DYSDERVLYLNCQG-DDLYVBEMSA-N |
| XLogP | 3.67 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.52 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|