C17H23NO8S — CID 25263061
8,8-dimethyl-7-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-4H-1,4-benzothiazine-3,5-dione (PubChem CID 25263061) has the molecular formula C17H23NO8S and a molecular weight of 401.44 g/mol. Its IUPAC name is 8,8-dimethyl-7-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-4H-1,4-benzothiazine-3,5-dione.
| Compound Name | 8,8-dimethyl-7-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-4H-1,4-benzothiazine-3,5-dione |
|---|---|
| PubChem CID | 25263061 |
| Molecular Formula | C17H23NO8S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 8,8-dimethyl-7-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-4H-1,4-benzothiazine-3,5-dione |
| SMILES | CC1(C)C(COC2OC(CO)C(O)C(O)C2O)=CC(=O)C2=C1SCC(=O)N2 |
| InChI | InChI=1S/C17H23NO8S/c1-17(2)7(3-8(20)11-15(17)27-6-10(21)18-11)5-25-16-14(24)13(23)12(22)9(4-19)26-16/h3,9,12-14,16,19,22-24H,4-6H2,1-2H3,(H,18,21) |
| InChIKey | AKXSDYSKIVXIJA-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 145.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |