C24H23N3O3 — CID 25264070
1-[[4-cyano-4-(2-methylphenyl)piperidin-1-yl]methyl]-4-oxoquinolizine-3-carboxylic acid (PubChem CID 25264070) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is 1-[[4-cyano-4-(2-methylphenyl)piperidin-1-yl]methyl]-4-oxoquinolizine-3-carboxylic acid.
| Compound Name | 1-[[4-cyano-4-(2-methylphenyl)piperidin-1-yl]methyl]-4-oxoquinolizine-3-carboxylic acid |
|---|---|
| PubChem CID | 25264070 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 1-[[4-cyano-4-(2-methylphenyl)piperidin-1-yl]methyl]-4-oxoquinolizine-3-carboxylic acid |
| SMILES | Cc1ccccc1C1(C#N)CCN(Cc2cc(C(=O)O)c(=O)n3ccccc23)CC1 |
| InChI | InChI=1S/C24H23N3O3/c1-17-6-2-3-7-20(17)24(16-25)9-12-26(13-10-24)15-18-14-19(23(29)30)22(28)27-11-5-4-8-21(18)27/h2-8,11,14H,9-10,12-13,15H2,1H3,(H,29,30) |
| InChIKey | AAHUJJYRQPPUBR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |