C17H15Cl2N3O2 — CID 25264246
5-(2-butoxy-3-pyridinyl)-3-(2,3-dichlorophenyl)-1,2,4-oxadiazole (PubChem CID 25264246) has the molecular formula C17H15Cl2N3O2 and a molecular weight of 364.23 g/mol. Its IUPAC name is 5-(2-butoxy-3-pyridinyl)-3-(2,3-dichlorophenyl)-1,2,4-oxadiazole.
| Compound Name | 5-(2-butoxy-3-pyridinyl)-3-(2,3-dichlorophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 25264246 |
| Molecular Formula | C17H15Cl2N3O2 |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | 5-(2-butoxy-3-pyridinyl)-3-(2,3-dichlorophenyl)-1,2,4-oxadiazole |
| SMILES | CCCCOc1ncccc1-c1nc(-c2cccc(Cl)c2Cl)no1 |
| InChI | InChI=1S/C17H15Cl2N3O2/c1-2-3-10-23-16-12(7-5-9-20-16)17-21-15(22-24-17)11-6-4-8-13(18)14(11)19/h4-9H,2-3,10H2,1H3 |
| InChIKey | OENWBIXTNLKQQI-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 61.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|