C17H17ClN4O — CID 46265224
N-butyl-3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]pyridin-2-amine (PubChem CID 46265224) has the molecular formula C17H17ClN4O and a molecular weight of 328.80 g/mol. Its IUPAC name is N-butyl-3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]pyridin-2-amine.
| Compound Name | N-butyl-3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 46265224 |
| Molecular Formula | C17H17ClN4O |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | N-butyl-3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]pyridin-2-amine |
| SMILES | CCCCNc1ncccc1-c1nc(-c2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C17H17ClN4O/c1-2-3-10-19-16-14(5-4-11-20-16)17-21-15(22-23-17)12-6-8-13(18)9-7-12/h4-9,11H,2-3,10H2,1H3,(H,19,20) |
| InChIKey | SBDPVCVJLIJEMF-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|