C17H16N4O2 — CID 46265210
3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-prop-2-enylpyridin-2-amine (PubChem CID 46265210) has the molecular formula C17H16N4O2 and a molecular weight of 308.34 g/mol. Its IUPAC name is 3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-prop-2-enylpyridin-2-amine.
| Compound Name | 3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-prop-2-enylpyridin-2-amine |
|---|---|
| PubChem CID | 46265210 |
| Molecular Formula | C17H16N4O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-prop-2-enylpyridin-2-amine |
| SMILES | C=CCNc1ncccc1-c1nc(-c2ccc(OC)cc2)no1 |
| InChI | InChI=1S/C17H16N4O2/c1-3-10-18-16-14(5-4-11-19-16)17-20-15(21-23-17)12-6-8-13(22-2)9-7-12/h3-9,11H,1,10H2,2H3,(H,18,19) |
| InChIKey | RTGPJJLWSXRMTG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|