C15H14N4O — CID 23613814
N-ethyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)pyridin-2-amine (PubChem CID 23613814) has the molecular formula C15H14N4O and a molecular weight of 266.30 g/mol. Its IUPAC name is N-ethyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)pyridin-2-amine.
| Compound Name | N-ethyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 23613814 |
| Molecular Formula | C15H14N4O |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | N-ethyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)pyridin-2-amine |
| SMILES | CCNc1ncccc1-c1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C15H14N4O/c1-2-16-14-12(9-6-10-17-14)15-18-13(19-20-15)11-7-4-3-5-8-11/h3-10H,2H2,1H3,(H,16,17) |
| InChIKey | ZRHUFBPTGXSZCS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |