About (4-chlorophenyl)methyl 4-[3-oxo-3-(2-oxo-1,3-dihydroindol-5-yl)propyl]piperazine-1-carboxylate
(4-chlorophenyl)methyl 4-[3-oxo-3-(2-oxo-1,3-dihydroindol-5-yl)propyl]piperazine-1-carboxylate (PubChem CID 25264585) has the molecular formula C23H24ClN3O4
and a molecular weight of 441.92 g/mol. Its IUPAC name is (4-chlorophenyl)methyl 4-[3-oxo-3-(2-oxo-1,3-dihydroindol-5-yl)propyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | (4-chlorophenyl)methyl 4-[3-oxo-3-(2-oxo-1,3-dihydroindol-5-yl)propyl]piperazine-1-carboxylate |
| PubChem CID | 25264585 |
| Molecular Formula | C23H24ClN3O4 |
| Molecular Weight | 441.92 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | (4-chlorophenyl)methyl 4-[3-oxo-3-(2-oxo-1,3-dihydroindol-5-yl)propyl]piperazine-1-carboxylate |
| SMILES | O=C1Cc2cc(C(=O)CCN3CCN(C(=O)OCc4ccc(Cl)cc4)CC3)ccc2N1 |
| InChI | InChI=1S/C23H24ClN3O4/c24-19-4-1-16(2-5-19)15-31-23(30)27-11-9-26(10-12-27)8-7-21(28)17-3-6-20-18(13-17)14-22(29)25-20/h1-6,13H,7-12,14-15H2,(H,25,29) |
| InChIKey | DKLIYTMOIRYXEN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.92 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-chlorophenyl)methyl 4-[3-oxo-3-(2-oxo-1,3-dihydroindol-5-yl)propyl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)methyl 4-[3-oxo-3-(2-oxo-1,3-dihydroindol-5-yl)propyl]piperazine-1-carboxylate?
The IUPAC name of (4-chlorophenyl)methyl 4-[3-oxo-3-(2-oxo-1,3-dihydroindol-5-yl)propyl]piperazine-1-carboxylate (CID 25264585) is (4-chlorophenyl)methyl 4-[3-oxo-3-(2-oxo-1,3-dihydroindol-5-yl)propyl]piperazine-1-carboxylate.
What is the SMILES notation for (4-chlorophenyl)methyl 4-[3-oxo-3-(2-oxo-1,3-dihydroindol-5-yl)propyl]piperazine-1-carboxylate?
The canonical SMILES for (4-chlorophenyl)methyl 4-[3-oxo-3-(2-oxo-1,3-dihydroindol-5-yl)propyl]piperazine-1-carboxylate is O=C1Cc2cc(C(=O)CCN3CCN(C(=O)OCc4ccc(Cl)cc4)CC3)ccc2N1.
What is the InChIKey of (4-chlorophenyl)methyl 4-[3-oxo-3-(2-oxo-1,3-dihydroindol-5-yl)propyl]piperazine-1-carboxylate?
The InChIKey is DKLIYTMOIRYXEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24ClN3O4/c24-19-4-1-16(2-5-19)15-31-23(30)27-11-9-26(10-12-27)8-7-21(28)17-3-6-20-18(13-17)14-22(29)25-20/h1-6,13H,7-12,14-15H2,(H,25,29).
What are the key properties of (4-chlorophenyl)methyl 4-[3-oxo-3-(2-oxo-1,3-dihydroindol-5-yl)propyl]piperazine-1-carboxylate?
(4-chlorophenyl)methyl 4-[3-oxo-3-(2-oxo-1,3-dihydroindol-5-yl)propyl]piperazine-1-carboxylate has a molecular weight of 441.92 g/mol, XLogP of 3.36, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)methyl 4-[3-oxo-3-(2-oxo-1,3-dihydroindol-5-yl)propyl]piperazine-1-carboxylate is sourced from PubChem (CID 25264585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).