C23H35N3O — CID 25264792
2,2,3,3-tetramethyl-N-[4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]cyclopropane-1-carboxamide (PubChem CID 25264792) has the molecular formula C23H35N3O and a molecular weight of 369.55 g/mol. Its IUPAC name is 2,2,3,3-tetramethyl-N-[4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]cyclopropane-1-carboxamide.
| Compound Name | 2,2,3,3-tetramethyl-N-[4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 25264792 |
| Molecular Formula | C23H35N3O |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.28 |
| IUPAC Name | 2,2,3,3-tetramethyl-N-[4-[3-(2-methylpyrrolidin-1-yl)pyrrolidin-1-yl]phenyl]cyclopropane-1-carboxamide |
| SMILES | CC1CCCN1C1CCN(c2ccc(NC(=O)C3C(C)(C)C3(C)C)cc2)C1 |
| InChI | InChI=1S/C23H35N3O/c1-16-7-6-13-26(16)19-12-14-25(15-19)18-10-8-17(9-11-18)24-21(27)20-22(2,3)23(20,4)5/h8-11,16,19-20H,6-7,12-15H2,1-5H3,(H,24,27) |
| InChIKey | ZETKRQDDYKMOPO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|