C22H24F2N2O3 — CID 25265200
1-[(4R)-6,8-difluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl]-3-[(7S)-7-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]urea (PubChem CID 25265200) has the molecular formula C22H24F2N2O3 and a molecular weight of 402.44 g/mol. Its IUPAC name is 1-[(4R)-6,8-difluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl]-3-[(7S)-7-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]urea.
| Compound Name | 1-[(4R)-6,8-difluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl]-3-[(7S)-7-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]urea |
|---|---|
| PubChem CID | 25265200 |
| Molecular Formula | C22H24F2N2O3 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 1-[(4R)-6,8-difluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl]-3-[(7S)-7-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]urea |
| SMILES | CC1(C)C[C@@H](NC(=O)Nc2cccc3c2C[C@@H](O)CC3)c2cc(F)cc(F)c2O1 |
| InChI | InChI=1S/C22H24F2N2O3/c1-22(2)11-19(16-8-13(23)9-17(24)20(16)29-22)26-21(28)25-18-5-3-4-12-6-7-14(27)10-15(12)18/h3-5,8-9,14,19,27H,6-7,10-11H2,1-2H3,(H2,25,26,28)/t14-,19+/m0/s1 |
| InChIKey | OWOQYIDOYXTZMR-IFXJQAMLSA-N |
| XLogP | 4.24 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |