C19H31NO5 — CID 25268064
4-[2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenol;2-hydroxypropanoic acid (PubChem CID 25268064) has the molecular formula C19H31NO5 and a molecular weight of 353.46 g/mol. Its IUPAC name is 4-[2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenol;2-hydroxypropanoic acid.
| Compound Name | 4-[2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenol;2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 25268064 |
| Molecular Formula | C19H31NO5 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | 4-[2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenol;2-hydroxypropanoic acid |
| SMILES | CC(O)C(=O)O.CN(C)CC(c1ccc(O)cc1)C1(O)CCCCC1 |
| InChI | InChI=1S/C16H25NO2.C3H6O3/c1-17(2)12-15(13-6-8-14(18)9-7-13)16(19)10-4-3-5-11-16;1-2(4)3(5)6/h6-9,15,18-19H,3-5,10-12H2,1-2H3;2,4H,1H3,(H,5,6) |
| InChIKey | AZOIOCPFLRFWSK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |