C10H10IN3S — CID 25270498
3-(4-iodophenyl)-4-methyl-5-methylsulfanyl-1,2,4-triazole (PubChem CID 25270498) has the molecular formula C10H10IN3S and a molecular weight of 331.18 g/mol. Its IUPAC name is 3-(4-iodophenyl)-4-methyl-5-methylsulfanyl-1,2,4-triazole.
| Compound Name | 3-(4-iodophenyl)-4-methyl-5-methylsulfanyl-1,2,4-triazole |
|---|---|
| PubChem CID | 25270498 |
| Molecular Formula | C10H10IN3S |
| Molecular Weight | 331.18 g/mol |
| Exact Mass | 330.96 |
| IUPAC Name | 3-(4-iodophenyl)-4-methyl-5-methylsulfanyl-1,2,4-triazole |
| SMILES | CSc1nnc(-c2ccc(I)cc2)n1C |
| InChI | InChI=1S/C10H10IN3S/c1-14-9(12-13-10(14)15-2)7-3-5-8(11)6-4-7/h3-6H,1-2H3 |
| InChIKey | PTEKFTYUDYUPQQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.18 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|