C30H27FN4O4S — CID 25270924
benzyl N-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamate (PubChem CID 25270924) has the molecular formula C30H27FN4O4S and a molecular weight of 558.64 g/mol. Its IUPAC name is benzyl N-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamate.
| Compound Name | benzyl N-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamate |
|---|---|
| PubChem CID | 25270924 |
| Molecular Formula | C30H27FN4O4S |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | benzyl N-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-2-pyridinyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamate |
| SMILES | COCCNCc1ccc(-c2cc3nccc(Oc4ccc(NC(=O)OCc5ccccc5)cc4F)c3s2)nc1 |
| InChI | InChI=1S/C30H27FN4O4S/c1-37-14-13-32-17-21-7-9-24(34-18-21)28-16-25-29(40-28)27(11-12-33-25)39-26-10-8-22(15-23(26)31)35-30(36)38-19-20-5-3-2-4-6-20/h2-12,15-16,18,32H,13-14,17,19H2,1H3,(H,35,36) |
| InChIKey | CWWGCYXQVWTHDQ-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|