C29H31N5 — CID 25271523
N-[4-(piperidin-1-ylmethyl)phenyl]-4-[2-(2-propan-2-ylphenyl)ethynyl]-7H-pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 25271523) has the molecular formula C29H31N5 and a molecular weight of 449.60 g/mol. Its IUPAC name is N-[4-(piperidin-1-ylmethyl)phenyl]-4-[2-(2-propan-2-ylphenyl)ethynyl]-7H-pyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | N-[4-(piperidin-1-ylmethyl)phenyl]-4-[2-(2-propan-2-ylphenyl)ethynyl]-7H-pyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 25271523 |
| Molecular Formula | C29H31N5 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.26 |
| IUPAC Name | N-[4-(piperidin-1-ylmethyl)phenyl]-4-[2-(2-propan-2-ylphenyl)ethynyl]-7H-pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | CC(C)c1ccccc1C#Cc1nc(Nc2ccc(CN3CCCCC3)cc2)nc2[nH]ccc12 |
| InChI | InChI=1S/C29H31N5/c1-21(2)25-9-5-4-8-23(25)12-15-27-26-16-17-30-28(26)33-29(32-27)31-24-13-10-22(11-14-24)20-34-18-6-3-7-19-34/h4-5,8-11,13-14,16-17,21H,3,6-7,18-20H2,1-2H3,(H2,30,31,32,33) |
| InChIKey | BVGZQYODZWBYLI-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|