C31H40N4O5S — CID 25271562
6-(ethylamino)-N-[(2S,3R)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-phenylbutan-2-yl]-1-methyl-2,2-dioxo-4,5-dihydro-3H-2λ6,1-benzothiazepine-8-carboxamide (PubChem CID 25271562) has the molecular formula C31H40N4O5S and a molecular weight of 580.75 g/mol. Its IUPAC name is 6-(ethylamino)-N-[(2S,3R)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-phenylbutan-2-yl]-1-methyl-2,2-dioxo-4,5-dihydro-3H-2λ6,1-benzothiazepine-8-carboxamide.
| Compound Name | 6-(ethylamino)-N-[(2S,3R)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-phenylbutan-2-yl]-1-methyl-2,2-dioxo-4,5-dihydro-3H-2λ6,1-benzothiazepine-8-carboxamide |
|---|---|
| PubChem CID | 25271562 |
| Molecular Formula | C31H40N4O5S |
| Molecular Weight | 580.75 g/mol |
| Exact Mass | 580.27 |
| IUPAC Name | 6-(ethylamino)-N-[(2S,3R)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-phenylbutan-2-yl]-1-methyl-2,2-dioxo-4,5-dihydro-3H-2λ6,1-benzothiazepine-8-carboxamide |
| SMILES | CCNc1cc(C(=O)N[C@@H](Cc2ccccc2)[C@H](O)CNCc2cccc(OC)c2)cc2c1CCCS(=O)(=O)N2C |
| InChI | InChI=1S/C31H40N4O5S/c1-4-33-27-18-24(19-29-26(27)14-9-15-41(38,39)35(29)2)31(37)34-28(17-22-10-6-5-7-11-22)30(36)21-32-20-23-12-8-13-25(16-23)40-3/h5-8,10-13,16,18-19,28,30,32-33,36H,4,9,14-15,17,20-21H2,1-3H3,(H,34,37)/t28-,30+/m0/s1 |
| InChIKey | JAQQVYMOVUUAHB-MFMCTBQISA-N |
| XLogP | 3.33 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.75 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |