C18H33N3O3S — CID 25274397
4-[[3-butyl-2-(4-methylpentylsulfonyl)imidazol-4-yl]methyl]morpholine (PubChem CID 25274397) has the molecular formula C18H33N3O3S and a molecular weight of 371.55 g/mol. Its IUPAC name is 4-[[3-butyl-2-(4-methylpentylsulfonyl)imidazol-4-yl]methyl]morpholine.
| Compound Name | 4-[[3-butyl-2-(4-methylpentylsulfonyl)imidazol-4-yl]methyl]morpholine |
|---|---|
| PubChem CID | 25274397 |
| Molecular Formula | C18H33N3O3S |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 4-[[3-butyl-2-(4-methylpentylsulfonyl)imidazol-4-yl]methyl]morpholine |
| SMILES | CCCCn1c(CN2CCOCC2)cnc1S(=O)(=O)CCCC(C)C |
| InChI | InChI=1S/C18H33N3O3S/c1-4-5-8-21-17(15-20-9-11-24-12-10-20)14-19-18(21)25(22,23)13-6-7-16(2)3/h14,16H,4-13,15H2,1-3H3 |
| InChIKey | HWPTXEAXKGZYJZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |