C23H32N4O2 — CID 25274515
[2-[1-[(1-ethylimidazol-2-yl)methyl]piperidin-4-yl]oxyphenyl]-piperidin-1-ylmethanone (PubChem CID 25274515) has the molecular formula C23H32N4O2 and a molecular weight of 396.54 g/mol. Its IUPAC name is [2-[1-[(1-ethylimidazol-2-yl)methyl]piperidin-4-yl]oxyphenyl]-piperidin-1-ylmethanone.
| Compound Name | [2-[1-[(1-ethylimidazol-2-yl)methyl]piperidin-4-yl]oxyphenyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 25274515 |
| Molecular Formula | C23H32N4O2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | [2-[1-[(1-ethylimidazol-2-yl)methyl]piperidin-4-yl]oxyphenyl]-piperidin-1-ylmethanone |
| SMILES | CCn1ccnc1CN1CCC(Oc2ccccc2C(=O)N2CCCCC2)CC1 |
| InChI | InChI=1S/C23H32N4O2/c1-2-26-17-12-24-22(26)18-25-15-10-19(11-16-25)29-21-9-5-4-8-20(21)23(28)27-13-6-3-7-14-27/h4-5,8-9,12,17,19H,2-3,6-7,10-11,13-16,18H2,1H3 |
| InChIKey | UGCYSJCVFDCGOW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |