C24H32N4O2 — CID 42291359
(4-ethylpiperazin-1-yl)-[2-[1-(pyridin-2-ylmethyl)piperidin-4-yl]oxyphenyl]methanone (PubChem CID 42291359) has the molecular formula C24H32N4O2 and a molecular weight of 408.55 g/mol. Its IUPAC name is (4-ethylpiperazin-1-yl)-[2-[1-(pyridin-2-ylmethyl)piperidin-4-yl]oxyphenyl]methanone.
| Compound Name | (4-ethylpiperazin-1-yl)-[2-[1-(pyridin-2-ylmethyl)piperidin-4-yl]oxyphenyl]methanone |
|---|---|
| PubChem CID | 42291359 |
| Molecular Formula | C24H32N4O2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | (4-ethylpiperazin-1-yl)-[2-[1-(pyridin-2-ylmethyl)piperidin-4-yl]oxyphenyl]methanone |
| SMILES | CCN1CCN(C(=O)c2ccccc2OC2CCN(Cc3ccccn3)CC2)CC1 |
| InChI | InChI=1S/C24H32N4O2/c1-2-26-15-17-28(18-16-26)24(29)22-8-3-4-9-23(22)30-21-10-13-27(14-11-21)19-20-7-5-6-12-25-20/h3-9,12,21H,2,10-11,13-19H2,1H3 |
| InChIKey | LBIYYCNYQVNJRK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |