C18H22FN3O3 — CID 25274700
5-[(2-fluorophenoxy)methyl]-N-[2-[(2S)-oxan-2-yl]ethyl]-1H-pyrazole-3-carboxamide (PubChem CID 25274700) has the molecular formula C18H22FN3O3 and a molecular weight of 347.39 g/mol. Its IUPAC name is 5-[(2-fluorophenoxy)methyl]-N-[2-[(2S)-oxan-2-yl]ethyl]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-[(2-fluorophenoxy)methyl]-N-[2-[(2S)-oxan-2-yl]ethyl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 25274700 |
| Molecular Formula | C18H22FN3O3 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 5-[(2-fluorophenoxy)methyl]-N-[2-[(2S)-oxan-2-yl]ethyl]-1H-pyrazole-3-carboxamide |
| SMILES | O=C(NCC[C@@H]1CCCCO1)c1cc(COc2ccccc2F)[nH]n1 |
| InChI | InChI=1S/C18H22FN3O3/c19-15-6-1-2-7-17(15)25-12-13-11-16(22-21-13)18(23)20-9-8-14-5-3-4-10-24-14/h1-2,6-7,11,14H,3-5,8-10,12H2,(H,20,23)(H,21,22)/t14-/m0/s1 |
| InChIKey | PULHDYKKEJMOTH-AWEZNQCLSA-N |
| XLogP | 2.82 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |