C18H16FN3O4 — CID 56744159
N-[(2,4-dihydroxyphenyl)methyl]-5-[(2-fluorophenoxy)methyl]-1H-pyrazole-3-carboxamide (PubChem CID 56744159) has the molecular formula C18H16FN3O4 and a molecular weight of 357.34 g/mol. Its IUPAC name is N-[(2,4-dihydroxyphenyl)methyl]-5-[(2-fluorophenoxy)methyl]-1H-pyrazole-3-carboxamide.
| Compound Name | N-[(2,4-dihydroxyphenyl)methyl]-5-[(2-fluorophenoxy)methyl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 56744159 |
| Molecular Formula | C18H16FN3O4 |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | N-[(2,4-dihydroxyphenyl)methyl]-5-[(2-fluorophenoxy)methyl]-1H-pyrazole-3-carboxamide |
| SMILES | O=C(NCc1ccc(O)cc1O)c1cc(COc2ccccc2F)[nH]n1 |
| InChI | InChI=1S/C18H16FN3O4/c19-14-3-1-2-4-17(14)26-10-12-7-15(22-21-12)18(25)20-9-11-5-6-13(23)8-16(11)24/h1-8,23-24H,9-10H2,(H,20,25)(H,21,22) |
| InChIKey | SEQBHSBNYVEMKF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 107.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|