C22H26N2O2 — CID 2527490
N-(2,3-dihydro-1H-inden-5-yl)-2-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]acetamide (PubChem CID 2527490) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-5-yl)-2-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]acetamide.
| Compound Name | N-(2,3-dihydro-1H-inden-5-yl)-2-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 2527490 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-5-yl)-2-[methyl-[(4-prop-2-enoxyphenyl)methyl]amino]acetamide |
| SMILES | C=CCOc1ccc(CN(C)CC(=O)Nc2ccc3c(c2)CCC3)cc1 |
| InChI | InChI=1S/C22H26N2O2/c1-3-13-26-21-11-7-17(8-12-21)15-24(2)16-22(25)23-20-10-9-18-5-4-6-19(18)14-20/h3,7-12,14H,1,4-6,13,15-16H2,2H3,(H,23,25) |
| InChIKey | NZFATVJPWQHVFG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|