C21H21N3O2 — CID 25276752
(3R)-N-(2-indol-1-ylethyl)-2-oxo-1-phenylpyrrolidine-3-carboxamide (PubChem CID 25276752) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is (3R)-N-(2-indol-1-ylethyl)-2-oxo-1-phenylpyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-(2-indol-1-ylethyl)-2-oxo-1-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 25276752 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | (3R)-N-(2-indol-1-ylethyl)-2-oxo-1-phenylpyrrolidine-3-carboxamide |
| SMILES | O=C(NCCn1ccc2ccccc21)[C@H]1CCN(c2ccccc2)C1=O |
| InChI | InChI=1S/C21H21N3O2/c25-20(18-11-14-24(21(18)26)17-7-2-1-3-8-17)22-12-15-23-13-10-16-6-4-5-9-19(16)23/h1-10,13,18H,11-12,14-15H2,(H,22,25)/t18-/m1/s1 |
| InChIKey | OGUVYVJLENZJKN-GOSISDBHSA-N |
| XLogP | 2.81 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|