C20H20N4O2 — CID 25279424
(3S)-N-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-oxo-1-phenylpyrrolidine-3-carboxamide (PubChem CID 25279424) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is (3S)-N-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-oxo-1-phenylpyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-oxo-1-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 25279424 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | (3S)-N-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-oxo-1-phenylpyrrolidine-3-carboxamide |
| SMILES | O=C(NCCc1cn2ccccc2n1)[C@@H]1CCN(c2ccccc2)C1=O |
| InChI | InChI=1S/C20H20N4O2/c25-19(17-10-13-24(20(17)26)16-6-2-1-3-7-16)21-11-9-15-14-23-12-5-4-8-18(23)22-15/h1-8,12,14,17H,9-11,13H2,(H,21,25)/t17-/m0/s1 |
| InChIKey | NSBUBXCVANXVBD-KRWDZBQOSA-N |
| XLogP | 2.05 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|