C14H16N4O — CID 125444630
(2R)-N-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2,5-dihydro-1H-pyrrole-2-carboxamide (PubChem CID 125444630) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is (2R)-N-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2,5-dihydro-1H-pyrrole-2-carboxamide.
| Compound Name | (2R)-N-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2,5-dihydro-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 125444630 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | (2R)-N-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2,5-dihydro-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NCCc1cn2ccccc2n1)[C@H]1C=CCN1 |
| InChI | InChI=1S/C14H16N4O/c19-14(12-4-3-7-15-12)16-8-6-11-10-18-9-2-1-5-13(18)17-11/h1-5,9-10,12,15H,6-8H2,(H,16,19)/t12-/m1/s1 |
| InChIKey | XHLRCUDLTIZOBC-GFCCVEGCSA-N |
| XLogP | 0.52 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|