C15H19N3O5S — CID 154904325
formic acid;N-(2-imidazo[1,2-a]pyridin-2-ylethyl)-1,1-dioxothiolane-3-carboxamide (PubChem CID 154904325) has the molecular formula C15H19N3O5S and a molecular weight of 353.40 g/mol. Its IUPAC name is formic acid;N-(2-imidazo[1,2-a]pyridin-2-ylethyl)-1,1-dioxothiolane-3-carboxamide.
| Compound Name | formic acid;N-(2-imidazo[1,2-a]pyridin-2-ylethyl)-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 154904325 |
| Molecular Formula | C15H19N3O5S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | formic acid;N-(2-imidazo[1,2-a]pyridin-2-ylethyl)-1,1-dioxothiolane-3-carboxamide |
| SMILES | O=C(NCCc1cn2ccccc2n1)C1CCS(=O)(=O)C1.O=CO |
| InChI | InChI=1S/C14H17N3O3S.CH2O2/c18-14(11-5-8-21(19,20)10-11)15-6-4-12-9-17-7-2-1-3-13(17)16-12;2-1-3/h1-3,7,9,11H,4-6,8,10H2,(H,15,18);1H,(H,2,3) |
| InChIKey | PWLRBIQMOJKPRN-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|