C27H35N3O3 — CID 25278100
1-(4-benzylpiperazin-1-yl)-3-[(3S)-1-(3-methoxybenzoyl)piperidin-3-yl]propan-1-one (PubChem CID 25278100) has the molecular formula C27H35N3O3 and a molecular weight of 449.60 g/mol. Its IUPAC name is 1-(4-benzylpiperazin-1-yl)-3-[(3S)-1-(3-methoxybenzoyl)piperidin-3-yl]propan-1-one.
| Compound Name | 1-(4-benzylpiperazin-1-yl)-3-[(3S)-1-(3-methoxybenzoyl)piperidin-3-yl]propan-1-one |
|---|---|
| PubChem CID | 25278100 |
| Molecular Formula | C27H35N3O3 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | 1-(4-benzylpiperazin-1-yl)-3-[(3S)-1-(3-methoxybenzoyl)piperidin-3-yl]propan-1-one |
| SMILES | COc1cccc(C(=O)N2CCC[C@@H](CCC(=O)N3CCN(Cc4ccccc4)CC3)C2)c1 |
| InChI | InChI=1S/C27H35N3O3/c1-33-25-11-5-10-24(19-25)27(32)30-14-6-9-23(21-30)12-13-26(31)29-17-15-28(16-18-29)20-22-7-3-2-4-8-22/h2-5,7-8,10-11,19,23H,6,9,12-18,20-21H2,1H3/t23-/m0/s1 |
| InChIKey | COTMVXBPVSVYST-QHCPKHFHSA-N |
| XLogP | 3.67 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |