C27H37N3O3 — CID 45187773
1-(4-benzylpiperazin-1-yl)-3-[1-[(2-hydroxy-3-methoxyphenyl)methyl]piperidin-3-yl]propan-1-one (PubChem CID 45187773) has the molecular formula C27H37N3O3 and a molecular weight of 451.61 g/mol. Its IUPAC name is 1-(4-benzylpiperazin-1-yl)-3-[1-[(2-hydroxy-3-methoxyphenyl)methyl]piperidin-3-yl]propan-1-one.
| Compound Name | 1-(4-benzylpiperazin-1-yl)-3-[1-[(2-hydroxy-3-methoxyphenyl)methyl]piperidin-3-yl]propan-1-one |
|---|---|
| PubChem CID | 45187773 |
| Molecular Formula | C27H37N3O3 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.28 |
| IUPAC Name | 1-(4-benzylpiperazin-1-yl)-3-[1-[(2-hydroxy-3-methoxyphenyl)methyl]piperidin-3-yl]propan-1-one |
| SMILES | COc1cccc(CN2CCCC(CCC(=O)N3CCN(Cc4ccccc4)CC3)C2)c1O |
| InChI | InChI=1S/C27H37N3O3/c1-33-25-11-5-10-24(27(25)32)21-29-14-6-9-23(20-29)12-13-26(31)30-17-15-28(16-18-30)19-22-7-3-2-4-8-22/h2-5,7-8,10-11,23,32H,6,9,12-21H2,1H3 |
| InChIKey | FIJMCURVBAOFEQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|