C24H29N3O — CID 25278228
(E)-1-[(5R)-9-(2-phenylethyl)-2,9-diazaspiro[4.5]decan-2-yl]-3-pyridin-2-ylprop-2-en-1-one (PubChem CID 25278228) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is (E)-1-[(5R)-9-(2-phenylethyl)-2,9-diazaspiro[4.5]decan-2-yl]-3-pyridin-2-ylprop-2-en-1-one.
| Compound Name | (E)-1-[(5R)-9-(2-phenylethyl)-2,9-diazaspiro[4.5]decan-2-yl]-3-pyridin-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 25278228 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | (E)-1-[(5R)-9-(2-phenylethyl)-2,9-diazaspiro[4.5]decan-2-yl]-3-pyridin-2-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccn1)N1CC[C@@]2(CCCN(CCc3ccccc3)C2)C1 |
| InChI | InChI=1S/C24H29N3O/c28-23(11-10-22-9-4-5-15-25-22)27-18-14-24(20-27)13-6-16-26(19-24)17-12-21-7-2-1-3-8-21/h1-5,7-11,15H,6,12-14,16-20H2/b11-10+/t24-/m1/s1 |
| InChIKey | ZYMLSEBCANCJFS-NFPSEPLVSA-N |
| XLogP | 3.65 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|