C25H31N3O — CID 45207374
(E)-1-[9-(3-phenylpropyl)-2,9-diazaspiro[4.5]decan-2-yl]-3-pyridin-4-ylprop-2-en-1-one (PubChem CID 45207374) has the molecular formula C25H31N3O and a molecular weight of 389.54 g/mol. Its IUPAC name is (E)-1-[9-(3-phenylpropyl)-2,9-diazaspiro[4.5]decan-2-yl]-3-pyridin-4-ylprop-2-en-1-one.
| Compound Name | (E)-1-[9-(3-phenylpropyl)-2,9-diazaspiro[4.5]decan-2-yl]-3-pyridin-4-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 45207374 |
| Molecular Formula | C25H31N3O |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | (E)-1-[9-(3-phenylpropyl)-2,9-diazaspiro[4.5]decan-2-yl]-3-pyridin-4-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccncc1)N1CCC2(CCCN(CCCc3ccccc3)C2)C1 |
| InChI | InChI=1S/C25H31N3O/c29-24(10-9-23-11-15-26-16-12-23)28-19-14-25(21-28)13-5-18-27(20-25)17-4-8-22-6-2-1-3-7-22/h1-3,6-7,9-12,15-16H,4-5,8,13-14,17-21H2/b10-9+ |
| InChIKey | PUJVJZKNFRXGIX-MDZDMXLPSA-N |
| XLogP | 4.04 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|