C20H27ClN2O3 — CID 25283323
N-[(3-chlorophenyl)methyl]-3-[1-[(3S)-oxolane-3-carbonyl]piperidin-4-yl]propanamide (PubChem CID 25283323) has the molecular formula C20H27ClN2O3 and a molecular weight of 378.90 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-3-[1-[(3S)-oxolane-3-carbonyl]piperidin-4-yl]propanamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-3-[1-[(3S)-oxolane-3-carbonyl]piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 25283323 |
| Molecular Formula | C20H27ClN2O3 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-3-[1-[(3S)-oxolane-3-carbonyl]piperidin-4-yl]propanamide |
| SMILES | O=C(CCC1CCN(C(=O)[C@H]2CCOC2)CC1)NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H27ClN2O3/c21-18-3-1-2-16(12-18)13-22-19(24)5-4-15-6-9-23(10-7-15)20(25)17-8-11-26-14-17/h1-3,12,15,17H,4-11,13-14H2,(H,22,24)/t17-/m0/s1 |
| InChIKey | YIKIKVVCAQPHLY-KRWDZBQOSA-N |
| XLogP | 3.01 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |