C23H29ClN2O2 — CID 42114617
3-[1-[(1R,2S,4R)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]piperidin-4-yl]-N-[(3-chlorophenyl)methyl]propanamide (PubChem CID 42114617) has the molecular formula C23H29ClN2O2 and a molecular weight of 400.95 g/mol. Its IUPAC name is 3-[1-[(1R,2S,4R)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]piperidin-4-yl]-N-[(3-chlorophenyl)methyl]propanamide.
| Compound Name | 3-[1-[(1R,2S,4R)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]piperidin-4-yl]-N-[(3-chlorophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 42114617 |
| Molecular Formula | C23H29ClN2O2 |
| Molecular Weight | 400.95 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 3-[1-[(1R,2S,4R)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]piperidin-4-yl]-N-[(3-chlorophenyl)methyl]propanamide |
| SMILES | O=C(CCC1CCN(C(=O)[C@H]2C[C@@H]3C=C[C@H]2C3)CC1)NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C23H29ClN2O2/c24-20-3-1-2-18(13-20)15-25-22(27)7-5-16-8-10-26(11-9-16)23(28)21-14-17-4-6-19(21)12-17/h1-4,6,13,16-17,19,21H,5,7-12,14-15H2,(H,25,27)/t17-,19+,21+/m1/s1 |
| InChIKey | DFUAYDGTMRKFLS-LMNJBCLMSA-N |
| XLogP | 4.19 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.95 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|