C26H35N3O2 — CID 42516202
3-[1-[(1R,2R,4R)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]piperidin-4-yl]-1-(4-phenylpiperazin-1-yl)propan-1-one (PubChem CID 42516202) has the molecular formula C26H35N3O2 and a molecular weight of 421.59 g/mol. Its IUPAC name is 3-[1-[(1R,2R,4R)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]piperidin-4-yl]-1-(4-phenylpiperazin-1-yl)propan-1-one.
| Compound Name | 3-[1-[(1R,2R,4R)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]piperidin-4-yl]-1-(4-phenylpiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 42516202 |
| Molecular Formula | C26H35N3O2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | 3-[1-[(1R,2R,4R)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]piperidin-4-yl]-1-(4-phenylpiperazin-1-yl)propan-1-one |
| SMILES | O=C(CCC1CCN(C(=O)[C@@H]2C[C@@H]3C=C[C@H]2C3)CC1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C26H35N3O2/c30-25(28-16-14-27(15-17-28)23-4-2-1-3-5-23)9-7-20-10-12-29(13-11-20)26(31)24-19-21-6-8-22(24)18-21/h1-6,8,20-22,24H,7,9-19H2/t21-,22+,24-/m1/s1 |
| InChIKey | XJWBHVQBSIOPNU-AOHZBQACSA-N |
| XLogP | 3.57 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|