C22H36N4O — CID 25288397
1-(1-pentan-3-ylpiperidin-4-yl)-N-(pyridin-3-ylmethyl)piperidine-4-carboxamide (PubChem CID 25288397) has the molecular formula C22H36N4O and a molecular weight of 372.56 g/mol. Its IUPAC name is 1-(1-pentan-3-ylpiperidin-4-yl)-N-(pyridin-3-ylmethyl)piperidine-4-carboxamide.
| Compound Name | 1-(1-pentan-3-ylpiperidin-4-yl)-N-(pyridin-3-ylmethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 25288397 |
| Molecular Formula | C22H36N4O |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.29 |
| IUPAC Name | 1-(1-pentan-3-ylpiperidin-4-yl)-N-(pyridin-3-ylmethyl)piperidine-4-carboxamide |
| SMILES | CCC(CC)N1CCC(N2CCC(C(=O)NCc3cccnc3)CC2)CC1 |
| InChI | InChI=1S/C22H36N4O/c1-3-20(4-2)25-14-9-21(10-15-25)26-12-7-19(8-13-26)22(27)24-17-18-6-5-11-23-16-18/h5-6,11,16,19-21H,3-4,7-10,12-15,17H2,1-2H3,(H,24,27) |
| InChIKey | OAZYRFLFUJANAV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |