C17H15FN2S — CID 25292365
N-[(7-fluoro-2-thiophen-3-ylquinolin-3-yl)methyl]cyclopropanamine (PubChem CID 25292365) has the molecular formula C17H15FN2S and a molecular weight of 298.39 g/mol. Its IUPAC name is N-[(7-fluoro-2-thiophen-3-ylquinolin-3-yl)methyl]cyclopropanamine.
| Compound Name | N-[(7-fluoro-2-thiophen-3-ylquinolin-3-yl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 25292365 |
| Molecular Formula | C17H15FN2S |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | N-[(7-fluoro-2-thiophen-3-ylquinolin-3-yl)methyl]cyclopropanamine |
| SMILES | Fc1ccc2cc(CNC3CC3)c(-c3ccsc3)nc2c1 |
| InChI | InChI=1S/C17H15FN2S/c18-14-2-1-11-7-13(9-19-15-3-4-15)17(20-16(11)8-14)12-5-6-21-10-12/h1-2,5-8,10,15,19H,3-4,9H2 |
| InChIKey | KRLBFEKICGALOF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |