C22H26N2O2S — CID 56856883
1-[[(7-methoxy-2-thiophen-3-ylquinolin-3-yl)methylamino]methyl]cyclohexan-1-ol (PubChem CID 56856883) has the molecular formula C22H26N2O2S and a molecular weight of 382.53 g/mol. Its IUPAC name is 1-[[(7-methoxy-2-thiophen-3-ylquinolin-3-yl)methylamino]methyl]cyclohexan-1-ol.
| Compound Name | 1-[[(7-methoxy-2-thiophen-3-ylquinolin-3-yl)methylamino]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 56856883 |
| Molecular Formula | C22H26N2O2S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 1-[[(7-methoxy-2-thiophen-3-ylquinolin-3-yl)methylamino]methyl]cyclohexan-1-ol |
| SMILES | COc1ccc2cc(CNCC3(O)CCCCC3)c(-c3ccsc3)nc2c1 |
| InChI | InChI=1S/C22H26N2O2S/c1-26-19-6-5-16-11-18(13-23-15-22(25)8-3-2-4-9-22)21(24-20(16)12-19)17-7-10-27-14-17/h5-7,10-12,14,23,25H,2-4,8-9,13,15H2,1H3 |
| InChIKey | FUGUVWOHCXLFNK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |