About 1-[[(2-thiophen-3-yl-1,3-thiazol-5-yl)methylamino]methyl]cyclohexan-1-ol
1-[[(2-thiophen-3-yl-1,3-thiazol-5-yl)methylamino]methyl]cyclohexan-1-ol (PubChem CID 111974624) has the molecular formula C15H20N2OS2
and a molecular weight of 308.47 g/mol. Its IUPAC name is 1-[[(2-thiophen-3-yl-1,3-thiazol-5-yl)methylamino]methyl]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 1-[[(2-thiophen-3-yl-1,3-thiazol-5-yl)methylamino]methyl]cyclohexan-1-ol |
| PubChem CID | 111974624 |
| Molecular Formula | C15H20N2OS2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 1-[[(2-thiophen-3-yl-1,3-thiazol-5-yl)methylamino]methyl]cyclohexan-1-ol |
| SMILES | OC1(CNCc2cnc(-c3ccsc3)s2)CCCCC1 |
| InChI | InChI=1S/C15H20N2OS2/c18-15(5-2-1-3-6-15)11-16-8-13-9-17-14(20-13)12-4-7-19-10-12/h4,7,9-10,16,18H,1-3,5-6,8,11H2 |
| InChIKey | IXXKLQRKYHPZMM-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[[(2-thiophen-3-yl-1,3-thiazol-5-yl)methylamino]methyl]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(2-thiophen-3-yl-1,3-thiazol-5-yl)methylamino]methyl]cyclohexan-1-ol?
The IUPAC name of 1-[[(2-thiophen-3-yl-1,3-thiazol-5-yl)methylamino]methyl]cyclohexan-1-ol (CID 111974624) is 1-[[(2-thiophen-3-yl-1,3-thiazol-5-yl)methylamino]methyl]cyclohexan-1-ol.
What is the SMILES notation for 1-[[(2-thiophen-3-yl-1,3-thiazol-5-yl)methylamino]methyl]cyclohexan-1-ol?
The canonical SMILES for 1-[[(2-thiophen-3-yl-1,3-thiazol-5-yl)methylamino]methyl]cyclohexan-1-ol is OC1(CNCc2cnc(-c3ccsc3)s2)CCCCC1.
What is the InChIKey of 1-[[(2-thiophen-3-yl-1,3-thiazol-5-yl)methylamino]methyl]cyclohexan-1-ol?
The InChIKey is IXXKLQRKYHPZMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2OS2/c18-15(5-2-1-3-6-15)11-16-8-13-9-17-14(20-13)12-4-7-19-10-12/h4,7,9-10,16,18H,1-3,5-6,8,11H2.
What are the key properties of 1-[[(2-thiophen-3-yl-1,3-thiazol-5-yl)methylamino]methyl]cyclohexan-1-ol?
1-[[(2-thiophen-3-yl-1,3-thiazol-5-yl)methylamino]methyl]cyclohexan-1-ol has a molecular weight of 308.47 g/mol, XLogP of 3.66, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(2-thiophen-3-yl-1,3-thiazol-5-yl)methylamino]methyl]cyclohexan-1-ol is sourced from PubChem (CID 111974624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).