C23H27N3O4 — CID 25295473
[2-(2-ethyl-6-methylanilino)-2-oxoethyl] 3-(3-ethyl-2-oxobenzimidazol-1-yl)propanoate (PubChem CID 25295473) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is [2-(2-ethyl-6-methylanilino)-2-oxoethyl] 3-(3-ethyl-2-oxobenzimidazol-1-yl)propanoate.
| Compound Name | [2-(2-ethyl-6-methylanilino)-2-oxoethyl] 3-(3-ethyl-2-oxobenzimidazol-1-yl)propanoate |
|---|---|
| PubChem CID | 25295473 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | [2-(2-ethyl-6-methylanilino)-2-oxoethyl] 3-(3-ethyl-2-oxobenzimidazol-1-yl)propanoate |
| SMILES | CCc1cccc(C)c1NC(=O)COC(=O)CCn1c(=O)n(CC)c2ccccc21 |
| InChI | InChI=1S/C23H27N3O4/c1-4-17-10-8-9-16(3)22(17)24-20(27)15-30-21(28)13-14-26-19-12-7-6-11-18(19)25(5-2)23(26)29/h6-12H,4-5,13-15H2,1-3H3,(H,24,27) |
| InChIKey | MPQDPJZXKDEEFW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |