C16H14N2OS2 — CID 2529752
N-(2-methyl-1,3-benzothiazol-6-yl)-2-phenylsulfanylacetamide (PubChem CID 2529752) has the molecular formula C16H14N2OS2 and a molecular weight of 314.44 g/mol. Its IUPAC name is N-(2-methyl-1,3-benzothiazol-6-yl)-2-phenylsulfanylacetamide.
| Compound Name | N-(2-methyl-1,3-benzothiazol-6-yl)-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 2529752 |
| Molecular Formula | C16H14N2OS2 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | N-(2-methyl-1,3-benzothiazol-6-yl)-2-phenylsulfanylacetamide |
| SMILES | Cc1nc2ccc(NC(=O)CSc3ccccc3)cc2s1 |
| InChI | InChI=1S/C16H14N2OS2/c1-11-17-14-8-7-12(9-15(14)21-11)18-16(19)10-20-13-5-3-2-4-6-13/h2-9H,10H2,1H3,(H,18,19) |
| InChIKey | RNZAMNSKXGQZEJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |