C25H31NO3 — CID 25306756
[(3S)-1-[(6-methoxy-2H-chromen-3-yl)methyl]-3-(2-phenylethyl)piperidin-3-yl]methanol (PubChem CID 25306756) has the molecular formula C25H31NO3 and a molecular weight of 393.53 g/mol. Its IUPAC name is [(3S)-1-[(6-methoxy-2H-chromen-3-yl)methyl]-3-(2-phenylethyl)piperidin-3-yl]methanol.
| Compound Name | [(3S)-1-[(6-methoxy-2H-chromen-3-yl)methyl]-3-(2-phenylethyl)piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 25306756 |
| Molecular Formula | C25H31NO3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | [(3S)-1-[(6-methoxy-2H-chromen-3-yl)methyl]-3-(2-phenylethyl)piperidin-3-yl]methanol |
| SMILES | COc1ccc2c(c1)C=C(CN1CCC[C@@](CO)(CCc3ccccc3)C1)CO2 |
| InChI | InChI=1S/C25H31NO3/c1-28-23-8-9-24-22(15-23)14-21(17-29-24)16-26-13-5-11-25(18-26,19-27)12-10-20-6-3-2-4-7-20/h2-4,6-9,14-15,27H,5,10-13,16-19H2,1H3/t25-/m1/s1 |
| InChIKey | KOZKNWPFUUCSOB-RUZDIDTESA-N |
| XLogP | 4.18 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |