C19H26N4O3 — CID 25309642
5-(2,6-dimethoxyphenyl)-3-[(3R)-3-propoxypiperidin-1-yl]-1,2,4-triazine (PubChem CID 25309642) has the molecular formula C19H26N4O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is 5-(2,6-dimethoxyphenyl)-3-[(3R)-3-propoxypiperidin-1-yl]-1,2,4-triazine.
| Compound Name | 5-(2,6-dimethoxyphenyl)-3-[(3R)-3-propoxypiperidin-1-yl]-1,2,4-triazine |
|---|---|
| PubChem CID | 25309642 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 5-(2,6-dimethoxyphenyl)-3-[(3R)-3-propoxypiperidin-1-yl]-1,2,4-triazine |
| SMILES | CCCO[C@@H]1CCCN(c2nncc(-c3c(OC)cccc3OC)n2)C1 |
| InChI | InChI=1S/C19H26N4O3/c1-4-11-26-14-7-6-10-23(13-14)19-21-15(12-20-22-19)18-16(24-2)8-5-9-17(18)25-3/h5,8-9,12,14H,4,6-7,10-11,13H2,1-3H3/t14-/m1/s1 |
| InChIKey | NTZARZHFAQRIMU-CQSZACIVSA-N |
| XLogP | 2.95 |
| TPSA | 69.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |