C17H23NO6 — CID 2531730
[2-oxo-2-(propan-2-ylamino)ethyl] 4-(3-ethoxy-4-hydroxyphenyl)-4-oxobutanoate (PubChem CID 2531730) has the molecular formula C17H23NO6 and a molecular weight of 337.37 g/mol. Its IUPAC name is [2-oxo-2-(propan-2-ylamino)ethyl] 4-(3-ethoxy-4-hydroxyphenyl)-4-oxobutanoate.
| Compound Name | [2-oxo-2-(propan-2-ylamino)ethyl] 4-(3-ethoxy-4-hydroxyphenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 2531730 |
| Molecular Formula | C17H23NO6 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | [2-oxo-2-(propan-2-ylamino)ethyl] 4-(3-ethoxy-4-hydroxyphenyl)-4-oxobutanoate |
| SMILES | CCOc1cc(C(=O)CCC(=O)OCC(=O)NC(C)C)ccc1O |
| InChI | InChI=1S/C17H23NO6/c1-4-23-15-9-12(5-6-14(15)20)13(19)7-8-17(22)24-10-16(21)18-11(2)3/h5-6,9,11,20H,4,7-8,10H2,1-3H3,(H,18,21) |
| InChIKey | IFLJRMIVQJPKHT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |