C21H18N2O4S2 — CID 25319317
N-[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-3-propan-2-ylsulfonylbenzamide (PubChem CID 25319317) has the molecular formula C21H18N2O4S2 and a molecular weight of 426.52 g/mol. Its IUPAC name is N-[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-3-propan-2-ylsulfonylbenzamide.
| Compound Name | N-[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-3-propan-2-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 25319317 |
| Molecular Formula | C21H18N2O4S2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | N-[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-3-propan-2-ylsulfonylbenzamide |
| SMILES | CC(C)S(=O)(=O)c1cccc(C(=O)Nc2nc(-c3cc4ccccc4o3)cs2)c1 |
| InChI | InChI=1S/C21H18N2O4S2/c1-13(2)29(25,26)16-8-5-7-15(10-16)20(24)23-21-22-17(12-28-21)19-11-14-6-3-4-9-18(14)27-19/h3-13H,1-2H3,(H,22,23,24) |
| InChIKey | ARQJPQIKDYNDGM-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |