C21H19N3O4S2 — CID 41255414
N-[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-3-(propan-2-ylsulfamoyl)benzamide (PubChem CID 41255414) has the molecular formula C21H19N3O4S2 and a molecular weight of 441.53 g/mol. Its IUPAC name is N-[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-3-(propan-2-ylsulfamoyl)benzamide.
| Compound Name | N-[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-3-(propan-2-ylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 41255414 |
| Molecular Formula | C21H19N3O4S2 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | N-[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-3-(propan-2-ylsulfamoyl)benzamide |
| SMILES | CC(C)NS(=O)(=O)c1cccc(C(=O)Nc2nc(-c3cc4ccccc4o3)cs2)c1 |
| InChI | InChI=1S/C21H19N3O4S2/c1-13(2)24-30(26,27)16-8-5-7-15(10-16)20(25)23-21-22-17(12-29-21)19-11-14-6-3-4-9-18(14)28-19/h3-13,24H,1-2H3,(H,22,23,25) |
| InChIKey | SFJTXYOCPOLDPT-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |