C28H33N3O6 — CID 25322040
ethyl (1S,3S,3aS,6aS)-5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-[4-(dimethylamino)phenyl]-4,6-dioxo-3-propyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 25322040) has the molecular formula C28H33N3O6 and a molecular weight of 507.59 g/mol. Its IUPAC name is ethyl (1S,3S,3aS,6aS)-5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-[4-(dimethylamino)phenyl]-4,6-dioxo-3-propyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | ethyl (1S,3S,3aS,6aS)-5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-[4-(dimethylamino)phenyl]-4,6-dioxo-3-propyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 25322040 |
| Molecular Formula | C28H33N3O6 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | ethyl (1S,3S,3aS,6aS)-5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-[4-(dimethylamino)phenyl]-4,6-dioxo-3-propyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | CCC[C@]1(C(=O)OCC)N[C@H](c2ccc(N(C)C)cc2)[C@H]2C(=O)N(c3ccc4c(c3)OCCO4)C(=O)[C@@H]21 |
| InChI | InChI=1S/C28H33N3O6/c1-5-13-28(27(34)35-6-2)23-22(24(29-28)17-7-9-18(10-8-17)30(3)4)25(32)31(26(23)33)19-11-12-20-21(16-19)37-15-14-36-20/h7-12,16,22-24,29H,5-6,13-15H2,1-4H3/t22-,23+,24+,28-/m0/s1 |
| InChIKey | SIDNEXDYTQIFQG-KVOKEACQSA-N |
| XLogP | 3.08 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|